C29H31NO2 — CID 10410163
(3S,5R)-3,4-dibenzyl-3-(3-methylbut-2-enyl)-5-phenylmorpholin-2-one (PubChem CID 10410163) has the molecular formula C29H31NO2 and a molecular weight of 425.57 g/mol. Its IUPAC name is (3S,5R)-3,4-dibenzyl-3-(3-methylbut-2-enyl)-5-phenylmorpholin-2-one.
| Compound Name | (3S,5R)-3,4-dibenzyl-3-(3-methylbut-2-enyl)-5-phenylmorpholin-2-one |
|---|---|
| PubChem CID | 10410163 |
| Molecular Formula | C29H31NO2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (3S,5R)-3,4-dibenzyl-3-(3-methylbut-2-enyl)-5-phenylmorpholin-2-one |
| SMILES | CC(C)=CC[C@]1(Cc2ccccc2)C(=O)OC[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C29H31NO2/c1-23(2)18-19-29(20-24-12-6-3-7-13-24)28(31)32-22-27(26-16-10-5-11-17-26)30(29)21-25-14-8-4-9-15-25/h3-18,27H,19-22H2,1-2H3/t27-,29-/m0/s1 |
| InChIKey | HMNRLLHCMWNWFP-YTMVLYRLSA-N |
| XLogP | 6.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|