C24H30ClN3O2 — CID 23761916
N-[[4-[[(2-chlorophenyl)methylcarbamoylamino]methyl]cyclohexyl]methyl]-2-phenylacetamide (PubChem CID 23761916) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-[[4-[[(2-chlorophenyl)methylcarbamoylamino]methyl]cyclohexyl]methyl]-2-phenylacetamide.
| Compound Name | N-[[4-[[(2-chlorophenyl)methylcarbamoylamino]methyl]cyclohexyl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 23761916 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[[4-[[(2-chlorophenyl)methylcarbamoylamino]methyl]cyclohexyl]methyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC1CCC(CNC(=O)NCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H30ClN3O2/c25-22-9-5-4-8-21(22)17-28-24(30)27-16-20-12-10-19(11-13-20)15-26-23(29)14-18-6-2-1-3-7-18/h1-9,19-20H,10-17H2,(H,26,29)(H2,27,28,30) |
| InChIKey | KQYFNRLWPAMDGQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |