C19H22N6O2 — CID 23766726
methyl 2-[5-[(2-aminoethylamino)-(4-phenylphenyl)methyl]tetrazol-1-yl]acetate (PubChem CID 23766726) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is methyl 2-[5-[(2-aminoethylamino)-(4-phenylphenyl)methyl]tetrazol-1-yl]acetate.
| Compound Name | methyl 2-[5-[(2-aminoethylamino)-(4-phenylphenyl)methyl]tetrazol-1-yl]acetate |
|---|---|
| PubChem CID | 23766726 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | methyl 2-[5-[(2-aminoethylamino)-(4-phenylphenyl)methyl]tetrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1nnnc1C(NCCN)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22N6O2/c1-27-17(26)13-25-19(22-23-24-25)18(21-12-11-20)16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-10,18,21H,11-13,20H2,1H3 |
| InChIKey | GCTNJUODHFTFCH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |