C18H22N4O3 — CID 23778456
8-[(2E)-2-[(4-imidazol-1-ylphenyl)methylidene]hydrazinyl]-8-oxooctanoic acid (PubChem CID 23778456) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 8-[(2E)-2-[(4-imidazol-1-ylphenyl)methylidene]hydrazinyl]-8-oxooctanoic acid.
| Compound Name | 8-[(2E)-2-[(4-imidazol-1-ylphenyl)methylidene]hydrazinyl]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 23778456 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 8-[(2E)-2-[(4-imidazol-1-ylphenyl)methylidene]hydrazinyl]-8-oxooctanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)N/N=C/c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c23-17(5-3-1-2-4-6-18(24)25)21-20-13-15-7-9-16(10-8-15)22-12-11-19-14-22/h7-14H,1-6H2,(H,21,23)(H,24,25)/b20-13+ |
| InChIKey | FODBAVMUSBIRME-DEDYPNTBSA-N |
| XLogP | 2.75 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|