C18H22ClN2OS+ — CID 2378391
(2-chlorophenyl)methyl-[2-oxo-2-(4-propan-2-ylsulfanylanilino)ethyl]azanium (PubChem CID 2378391) has the molecular formula C18H22ClN2OS+ and a molecular weight of 349.91 g/mol. Its IUPAC name is (2-chlorophenyl)methyl-[2-oxo-2-(4-propan-2-ylsulfanylanilino)ethyl]azanium.
| Compound Name | (2-chlorophenyl)methyl-[2-oxo-2-(4-propan-2-ylsulfanylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 2378391 |
| Molecular Formula | C18H22ClN2OS+ |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (2-chlorophenyl)methyl-[2-oxo-2-(4-propan-2-ylsulfanylanilino)ethyl]azanium |
| SMILES | CC(C)Sc1ccc(NC(=O)C[NH2+]Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H21ClN2OS/c1-13(2)23-16-9-7-15(8-10-16)21-18(22)12-20-11-14-5-3-4-6-17(14)19/h3-10,13,20H,11-12H2,1-2H3,(H,21,22)/p+1 |
| InChIKey | UXTNFPGNVMLQGD-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |