C35H39BrN4O4 — CID 23789105
(3R,3'S,4'R,5'R)-7-bromo-5'-[2-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]ethyl]-4'-[2-(4-methoxyphenyl)propan-2-yl]-1,3',5-trimethylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23789105) has the molecular formula C35H39BrN4O4 and a molecular weight of 659.63 g/mol. Its IUPAC name is (3R,3'S,4'R,5'R)-7-bromo-5'-[2-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]ethyl]-4'-[2-(4-methoxyphenyl)propan-2-yl]-1,3',5-trimethylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'S,4'R,5'R)-7-bromo-5'-[2-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]ethyl]-4'-[2-(4-methoxyphenyl)propan-2-yl]-1,3',5-trimethylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23789105 |
| Molecular Formula | C35H39BrN4O4 |
| Molecular Weight | 659.63 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | (3R,3'S,4'R,5'R)-7-bromo-5'-[2-[4-[(R)-hydroxy(phenyl)methyl]triazol-1-yl]ethyl]-4'-[2-(4-methoxyphenyl)propan-2-yl]-1,3',5-trimethylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc(C(C)(C)[C@@H]2[C@@H](CCn3cc([C@H](O)c4ccccc4)nn3)O[C@]3(C(=O)N(C)c4c(Br)cc(C)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C35H39BrN4O4/c1-21-18-26-31(27(36)19-21)39(5)33(42)35(26)22(2)30(34(3,4)24-12-14-25(43-6)15-13-24)29(44-35)16-17-40-20-28(37-38-40)32(41)23-10-8-7-9-11-23/h7-15,18-20,22,29-30,32,41H,16-17H2,1-6H3/t22-,29+,30-,32+,35+/m0/s1 |
| InChIKey | KNERNHKHOZMIGE-UBPWAUTASA-N |
| XLogP | 6.33 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |