C18H16Cl2N2O — CID 23794624
2-(2,4-dichloroanilino)-3-(4-propoxyphenyl)prop-2-enenitrile (PubChem CID 23794624) has the molecular formula C18H16Cl2N2O and a molecular weight of 347.25 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-3-(4-propoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(2,4-dichloroanilino)-3-(4-propoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 23794624 |
| Molecular Formula | C18H16Cl2N2O |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(2,4-dichloroanilino)-3-(4-propoxyphenyl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(C=C(C#N)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O/c1-2-9-23-16-6-3-13(4-7-16)10-15(12-21)22-18-8-5-14(19)11-17(18)20/h3-8,10-11,22H,2,9H2,1H3 |
| InChIKey | VSDGQQSBJLTJQE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|