C15H9Cl3N2 — CID 19165880
(E)-3-(4-chlorophenyl)-2-(2,5-dichloroanilino)prop-2-enenitrile (PubChem CID 19165880) has the molecular formula C15H9Cl3N2 and a molecular weight of 323.61 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-(2,5-dichloroanilino)prop-2-enenitrile.
| Compound Name | (E)-3-(4-chlorophenyl)-2-(2,5-dichloroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 19165880 |
| Molecular Formula | C15H9Cl3N2 |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-(2,5-dichloroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(Cl)cc1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H9Cl3N2/c16-11-3-1-10(2-4-11)7-13(9-19)20-15-8-12(17)5-6-14(15)18/h1-8,20H/b13-7+ |
| InChIKey | GGNJTFPQSQHMAJ-NTUHNPAUSA-N |
| XLogP | 5.62 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|