C24H20N4O8S3 — CID 23795029
[2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate (PubChem CID 23795029) has the molecular formula C24H20N4O8S3 and a molecular weight of 588.65 g/mol. Its IUPAC name is [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate.
| Compound Name | [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 23795029 |
| Molecular Formula | C24H20N4O8S3 |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | [2-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetate |
| SMILES | CN(c1ccc(OCC(=O)OCC(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C24H20N4O8S3/c1-27(39(33,34)23-6-3-11-37-23)17-7-9-19(10-8-17)35-14-22(30)36-13-21(29)26-24-25-20(15-38-24)16-4-2-5-18(12-16)28(31)32/h2-12,15H,13-14H2,1H3,(H,25,26,29) |
| InChIKey | ZHCKXIYRVQZQHN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 158.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|