C19H23N5OS2 — CID 23801560
2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 23801560) has the molecular formula C19H23N5OS2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 23801560 |
| Molecular Formula | C19H23N5OS2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCC(Sc1nc2c(cc1C#N)CCCCCC2)C(=O)Nc1nnc(C)s1 |
| InChI | InChI=1S/C19H23N5OS2/c1-3-16(17(25)22-19-24-23-12(2)26-19)27-18-14(11-20)10-13-8-6-4-5-7-9-15(13)21-18/h10,16H,3-9H2,1-2H3,(H,22,24,25) |
| InChIKey | ZOJHJICNIUVCKU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |