C21H24N4OS — CID 23942468
2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-pyridin-2-ylbutanamide (PubChem CID 23942468) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-pyridin-2-ylbutanamide.
| Compound Name | 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 23942468 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-pyridin-2-ylbutanamide |
| SMILES | CCC(Sc1nc2c(cc1C#N)CCCCCC2)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C21H24N4OS/c1-2-18(20(26)25-19-11-7-8-12-23-19)27-21-16(14-22)13-15-9-5-3-4-6-10-17(15)24-21/h7-8,11-13,18H,2-6,9-10H2,1H3,(H,23,25,26) |
| InChIKey | RKYXLHHQPFOMOW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |