C22H24ClN3OS — CID 23998145
N-(2-chlorophenyl)-2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]butanamide (PubChem CID 23998145) has the molecular formula C22H24ClN3OS and a molecular weight of 413.97 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]butanamide.
| Compound Name | N-(2-chlorophenyl)-2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 23998145 |
| Molecular Formula | C22H24ClN3OS |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1nc2c(cc1C#N)CCCCCC2)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H24ClN3OS/c1-2-20(21(27)25-19-12-8-7-10-17(19)23)28-22-16(14-24)13-15-9-5-3-4-6-11-18(15)26-22/h7-8,10,12-13,20H,2-6,9,11H2,1H3,(H,25,27) |
| InChIKey | PDLNCBRQIDEFEC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |