C21H22FN3OS — CID 23830479
2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(2-fluorophenyl)propanamide (PubChem CID 23830479) has the molecular formula C21H22FN3OS and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(2-fluorophenyl)propanamide.
| Compound Name | 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 23830479 |
| Molecular Formula | C21H22FN3OS |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(2-fluorophenyl)propanamide |
| SMILES | CC(Sc1nc2c(cc1C#N)CCCCCC2)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C21H22FN3OS/c1-14(20(26)24-19-11-7-6-9-17(19)22)27-21-16(13-23)12-15-8-4-2-3-5-10-18(15)25-21/h6-7,9,11-12,14H,2-5,8,10H2,1H3,(H,24,26) |
| InChIKey | MIKUDNICHDMFPA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |