C23H25N3O3S — CID 23914716
methyl 2-[2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]propanoylamino]benzoate (PubChem CID 23914716) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is methyl 2-[2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]propanoylamino]benzoate.
| Compound Name | methyl 2-[2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 23914716 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | methyl 2-[2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]propanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(C)Sc1nc2c(cc1C#N)CCCCCC2 |
| InChI | InChI=1S/C23H25N3O3S/c1-15(21(27)25-20-12-8-7-10-18(20)23(28)29-2)30-22-17(14-24)13-16-9-5-3-4-6-11-19(16)26-22/h7-8,10,12-13,15H,3-6,9,11H2,1-2H3,(H,25,27) |
| InChIKey | WYZSLBQWWHLOFF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |