C21H21Cl2N3OS — CID 23886612
2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(2,3-dichlorophenyl)propanamide (PubChem CID 23886612) has the molecular formula C21H21Cl2N3OS and a molecular weight of 434.39 g/mol. Its IUPAC name is 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(2,3-dichlorophenyl)propanamide.
| Compound Name | 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(2,3-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 23886612 |
| Molecular Formula | C21H21Cl2N3OS |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 2-[(3-cyano-5,6,7,8,9,10-hexahydrocycloocta[b]pyridin-2-yl)sulfanyl]-N-(2,3-dichlorophenyl)propanamide |
| SMILES | CC(Sc1nc2c(cc1C#N)CCCCCC2)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H21Cl2N3OS/c1-13(20(27)25-18-10-6-8-16(22)19(18)23)28-21-15(12-24)11-14-7-4-2-3-5-9-17(14)26-21/h6,8,10-11,13H,2-5,7,9H2,1H3,(H,25,27) |
| InChIKey | ZICZIGAXWYDZDD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |