C24H22N4O6 — CID 23804678
ethyl 1,3-dimethyl-5-(2-nitrophenyl)-2,4-dioxo-7-phenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23804678) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is ethyl 1,3-dimethyl-5-(2-nitrophenyl)-2,4-dioxo-7-phenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 1,3-dimethyl-5-(2-nitrophenyl)-2,4-dioxo-7-phenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23804678 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | ethyl 1,3-dimethyl-5-(2-nitrophenyl)-2,4-dioxo-7-phenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)Nc2c(c(=O)n(C)c(=O)n2C)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H22N4O6/c1-4-34-23(30)18-17(15-12-8-9-13-16(15)28(32)33)19-21(26(2)24(31)27(3)22(19)29)25-20(18)14-10-6-5-7-11-14/h5-13,17,25H,4H2,1-3H3 |
| InChIKey | ZOVYSYFYMOKKGT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|