C16H14N4O7 — CID 23961714
ethyl 7-amino-5-(2-nitrophenyl)-2,4-dioxo-1,5-dihydropyrano[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23961714) has the molecular formula C16H14N4O7 and a molecular weight of 374.31 g/mol. Its IUPAC name is ethyl 7-amino-5-(2-nitrophenyl)-2,4-dioxo-1,5-dihydropyrano[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-amino-5-(2-nitrophenyl)-2,4-dioxo-1,5-dihydropyrano[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23961714 |
| Molecular Formula | C16H14N4O7 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | ethyl 7-amino-5-(2-nitrophenyl)-2,4-dioxo-1,5-dihydropyrano[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2[nH]c(=O)[nH]c(=O)c2C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N4O7/c1-2-26-15(22)10-9(7-5-3-4-6-8(7)20(24)25)11-13(21)18-16(23)19-14(11)27-12(10)17/h3-6,9H,2,17H2,1H3,(H2,18,19,21,23) |
| InChIKey | MALMVAXXWHJJDM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 170.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|