C14H16Br2O4 — CID 23807561
(E,6S,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxy-6-methylhept-2-enoic acid (PubChem CID 23807561) has the molecular formula C14H16Br2O4 and a molecular weight of 408.09 g/mol. Its IUPAC name is (E,6S,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxy-6-methylhept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxy-6-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 23807561 |
| Molecular Formula | C14H16Br2O4 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | (E,6S,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxy-6-methylhept-2-enoic acid |
| SMILES | C[C@@H](CC/C=C/C(=O)O)[C@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C14H16Br2O4/c1-8(4-2-3-5-12(17)18)13(19)10-6-9(15)7-11(16)14(10)20/h3,5-8,13,19-20H,2,4H2,1H3,(H,17,18)/b5-3+/t8-,13-/m0/s1 |
| InChIKey | XQGCALWARCEHNQ-YKEUZCRDSA-N |
| XLogP | 4.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|