C24H35BrN2O6 — CID 23811197
(5R,6S,7R)-8-bromo-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23811197) has the molecular formula C24H35BrN2O6 and a molecular weight of 527.46 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5R,6S,7R)-8-bromo-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23811197 |
| Molecular Formula | C24H35BrN2O6 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-[cyclohexyl(prop-2-enyl)carbamoyl]-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@H](C(=O)O)[C@H]3OC12CC3Br)C1CCCCC1 |
| InChI | InChI=1S/C24H35BrN2O6/c1-2-11-26(15-9-5-3-6-10-15)22(30)20-24-14-16(25)19(33-24)17(23(31)32)18(24)21(29)27(20)12-7-4-8-13-28/h2,15-20,28H,1,3-14H2,(H,31,32)/t16?,17-,18-,19-,20?,24?/m0/s1 |
| InChIKey | FKOVWTNONDPFBN-AHVPKAEVSA-N |
| XLogP | 2.33 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|