C26H34N2O5 — CID 23817917
(E,5R,6S)-N-benzyl-N-(2-hydroxyethyl)-6-[4-[[(2S)-2-hydroxypropanoyl]amino]phenyl]-6-methoxy-5-methylhex-3-enamide (PubChem CID 23817917) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is (E,5R,6S)-N-benzyl-N-(2-hydroxyethyl)-6-[4-[[(2S)-2-hydroxypropanoyl]amino]phenyl]-6-methoxy-5-methylhex-3-enamide.
| Compound Name | (E,5R,6S)-N-benzyl-N-(2-hydroxyethyl)-6-[4-[[(2S)-2-hydroxypropanoyl]amino]phenyl]-6-methoxy-5-methylhex-3-enamide |
|---|---|
| PubChem CID | 23817917 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (E,5R,6S)-N-benzyl-N-(2-hydroxyethyl)-6-[4-[[(2S)-2-hydroxypropanoyl]amino]phenyl]-6-methoxy-5-methylhex-3-enamide |
| SMILES | CO[C@H](c1ccc(NC(=O)[C@H](C)O)cc1)[C@H](C)/C=C/CC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C26H34N2O5/c1-19(25(33-3)22-12-14-23(15-13-22)27-26(32)20(2)30)8-7-11-24(31)28(16-17-29)18-21-9-5-4-6-10-21/h4-10,12-15,19-20,25,29-30H,11,16-18H2,1-3H3,(H,27,32)/b8-7+/t19-,20+,25+/m1/s1 |
| InChIKey | OINGVPJYNLPFCA-OORPIGQOSA-N |
| XLogP | 3.30 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|