C28H36N2O4 — CID 23958145
(E,5R,6S)-N-benzyl-N-(2-hydroxyethyl)-6-methoxy-5-methyl-6-[4-(2-oxopiperidin-1-yl)phenyl]hex-3-enamide (PubChem CID 23958145) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is (E,5R,6S)-N-benzyl-N-(2-hydroxyethyl)-6-methoxy-5-methyl-6-[4-(2-oxopiperidin-1-yl)phenyl]hex-3-enamide.
| Compound Name | (E,5R,6S)-N-benzyl-N-(2-hydroxyethyl)-6-methoxy-5-methyl-6-[4-(2-oxopiperidin-1-yl)phenyl]hex-3-enamide |
|---|---|
| PubChem CID | 23958145 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (E,5R,6S)-N-benzyl-N-(2-hydroxyethyl)-6-methoxy-5-methyl-6-[4-(2-oxopiperidin-1-yl)phenyl]hex-3-enamide |
| SMILES | CO[C@H](c1ccc(N2CCCCC2=O)cc1)[C@H](C)/C=C/CC(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C28H36N2O4/c1-22(9-8-13-26(32)29(19-20-31)21-23-10-4-3-5-11-23)28(34-2)24-14-16-25(17-15-24)30-18-7-6-12-27(30)33/h3-5,8-11,14-17,22,28,31H,6-7,12-13,18-21H2,1-2H3/b9-8+/t22-,28+/m1/s1 |
| InChIKey | PYYHCZZOKPONTC-DHMJWRNHSA-N |
| XLogP | 4.49 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|