C24H29N3O4 — CID 23820602
[2-[[4-[1-[(4-aminocyclohexyl)amino]-1-oxopropan-2-yl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 23820602) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is [2-[[4-[1-[(4-aminocyclohexyl)amino]-1-oxopropan-2-yl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [2-[[4-[1-[(4-aminocyclohexyl)amino]-1-oxopropan-2-yl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 23820602 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | [2-[[4-[1-[(4-aminocyclohexyl)amino]-1-oxopropan-2-yl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)Nc1ccc(C(C)C(=O)NC2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-15(23(29)26-20-13-9-18(25)10-14-20)17-7-11-19(12-8-17)27-24(30)21-5-3-4-6-22(21)31-16(2)28/h3-8,11-12,15,18,20H,9-10,13-14,25H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | MVVVFDYWYFBIRB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|