C24H19Cl3N2O5S — CID 23824667
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate (PubChem CID 23824667) has the molecular formula C24H19Cl3N2O5S and a molecular weight of 553.85 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 23824667 |
| Molecular Formula | C24H19Cl3N2O5S |
| Molecular Weight | 553.85 g/mol |
| Exact Mass | 552.01 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 3-(2,3-dihydroindol-1-ylsulfonyl)benzoate |
| SMILES | CC(OC(=O)c1cccc(S(=O)(=O)N2CCc3ccccc32)c1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C24H19Cl3N2O5S/c1-14(23(30)28-21-13-19(26)18(25)12-20(21)27)34-24(31)16-6-4-7-17(11-16)35(32,33)29-10-9-15-5-2-3-8-22(15)29/h2-8,11-14H,9-10H2,1H3,(H,28,30) |
| InChIKey | UUJZIBIHDPNEEB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.85 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|