C22H25ClFN3O2 — CID 23825031
N-[3-[[acetyl-(4-aminocyclohexyl)amino]methyl]-4-chlorophenyl]-4-fluorobenzamide (PubChem CID 23825031) has the molecular formula C22H25ClFN3O2 and a molecular weight of 417.91 g/mol. Its IUPAC name is N-[3-[[acetyl-(4-aminocyclohexyl)amino]methyl]-4-chlorophenyl]-4-fluorobenzamide.
| Compound Name | N-[3-[[acetyl-(4-aminocyclohexyl)amino]methyl]-4-chlorophenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 23825031 |
| Molecular Formula | C22H25ClFN3O2 |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-[3-[[acetyl-(4-aminocyclohexyl)amino]methyl]-4-chlorophenyl]-4-fluorobenzamide |
| SMILES | CC(=O)N(Cc1cc(NC(=O)c2ccc(F)cc2)ccc1Cl)C1CCC(N)CC1 |
| InChI | InChI=1S/C22H25ClFN3O2/c1-14(28)27(20-9-6-18(25)7-10-20)13-16-12-19(8-11-21(16)23)26-22(29)15-2-4-17(24)5-3-15/h2-5,8,11-12,18,20H,6-7,9-10,13,25H2,1H3,(H,26,29) |
| InChIKey | QKAOPTWUGJBSIB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |