C16H17FNO3+ — CID 23828171
[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene-hydroxy-methylazanium (PubChem CID 23828171) has the molecular formula C16H17FNO3+ and a molecular weight of 290.31 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene-hydroxy-methylazanium.
| Compound Name | [4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene-hydroxy-methylazanium |
|---|---|
| PubChem CID | 23828171 |
| Molecular Formula | C16H17FNO3+ |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene-hydroxy-methylazanium |
| SMILES | COc1cc(C=[N+](C)O)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H17FNO3/c1-18(19)10-13-5-8-15(16(9-13)20-2)21-11-12-3-6-14(17)7-4-12/h3-10,19H,11H2,1-2H3/q+1 |
| InChIKey | VMWCCIPHFGVTRP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|