C17H20N4O5S2 — CID 23829360
phenyl 2-(2-aminoethylcarbamoyl)-3-thiophen-2-ylsulfonylimidazolidine-1-carboxylate (PubChem CID 23829360) has the molecular formula C17H20N4O5S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is phenyl 2-(2-aminoethylcarbamoyl)-3-thiophen-2-ylsulfonylimidazolidine-1-carboxylate.
| Compound Name | phenyl 2-(2-aminoethylcarbamoyl)-3-thiophen-2-ylsulfonylimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 23829360 |
| Molecular Formula | C17H20N4O5S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | phenyl 2-(2-aminoethylcarbamoyl)-3-thiophen-2-ylsulfonylimidazolidine-1-carboxylate |
| SMILES | NCCNC(=O)C1N(C(=O)Oc2ccccc2)CCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H20N4O5S2/c18-8-9-19-15(22)16-20(17(23)26-13-5-2-1-3-6-13)10-11-21(16)28(24,25)14-7-4-12-27-14/h1-7,12,16H,8-11,18H2,(H,19,22) |
| InChIKey | RABDGBXOSZPJRZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |