C18H16N4O4 — CID 23831459
[2-oxo-2-[(3-oxo-2-phenyl-1H-pyrazol-5-yl)amino]ethyl] 4-aminobenzoate (PubChem CID 23831459) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is [2-oxo-2-[(3-oxo-2-phenyl-1H-pyrazol-5-yl)amino]ethyl] 4-aminobenzoate.
| Compound Name | [2-oxo-2-[(3-oxo-2-phenyl-1H-pyrazol-5-yl)amino]ethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 23831459 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [2-oxo-2-[(3-oxo-2-phenyl-1H-pyrazol-5-yl)amino]ethyl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(=O)Nc2cc(=O)n(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C18H16N4O4/c19-13-8-6-12(7-9-13)18(25)26-11-16(23)20-15-10-17(24)22(21-15)14-4-2-1-3-5-14/h1-10,21H,11,19H2,(H,20,23) |
| InChIKey | MJBJLVQSFCLZHC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|