C22H20N4O2S3 — CID 2383978
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-oxo-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)butanamide (PubChem CID 2383978) has the molecular formula C22H20N4O2S3 and a molecular weight of 468.63 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-oxo-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)butanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-oxo-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)butanamide |
|---|---|
| PubChem CID | 2383978 |
| Molecular Formula | C22H20N4O2S3 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-oxo-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)butanamide |
| SMILES | N#Cc1c(NC(=O)CC(=O)CSc2ncnc3sc4c(c23)CCC4)sc2c1CCCC2 |
| InChI | InChI=1S/C22H20N4O2S3/c23-9-15-13-4-1-2-6-16(13)30-20(15)26-18(28)8-12(27)10-29-21-19-14-5-3-7-17(14)31-22(19)25-11-24-21/h11H,1-8,10H2,(H,26,28) |
| InChIKey | HGTUFYBQWKCFLN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|