C23H29N3O5 — CID 23852138
2-[[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl-(oxolan-2-ylmethyl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 23852138) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl-(oxolan-2-ylmethyl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl-(oxolan-2-ylmethyl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 23852138 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[[(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)methyl-(oxolan-2-ylmethyl)amino]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1CN(CC1CCCO1)CN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C23H29N3O5/c27-20-16-7-1-2-8-17(16)21(28)25(20)13-24(12-15-6-5-11-31-15)14-26-22(29)18-9-3-4-10-19(18)23(26)30/h1-4,15-19H,5-14H2 |
| InChIKey | HYAJCCBNSJQSKQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|