C23H17NO4 — CID 23853303
ethyl 2-(5,7-dioxo-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaen-6-yl)benzoate (PubChem CID 23853303) has the molecular formula C23H17NO4 and a molecular weight of 371.39 g/mol. Its IUPAC name is ethyl 2-(5,7-dioxo-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaen-6-yl)benzoate.
| Compound Name | ethyl 2-(5,7-dioxo-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaen-6-yl)benzoate |
|---|---|
| PubChem CID | 23853303 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl 2-(5,7-dioxo-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaen-6-yl)benzoate |
| SMILES | CCOC(=O)c1ccccc1N1C(=O)c2ccc3c4c(ccc(c24)C1=O)CC3 |
| InChI | InChI=1S/C23H17NO4/c1-2-28-23(27)15-5-3-4-6-18(15)24-21(25)16-11-9-13-7-8-14-10-12-17(22(24)26)20(16)19(13)14/h3-6,9-12H,2,7-8H2,1H3 |
| InChIKey | BCXFMPPEJUARLS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|