C25H26ClN3O3S — CID 23855671
2-[[4-[[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]amino]-3-methylbutanoic acid (PubChem CID 23855671) has the molecular formula C25H26ClN3O3S and a molecular weight of 484.02 g/mol. Its IUPAC name is 2-[[4-[[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-[[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 23855671 |
| Molecular Formula | C25H26ClN3O3S |
| Molecular Weight | 484.02 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-[[4-[[[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]amino]-3-methylbutanoic acid |
| SMILES | C=CCN(Cc1ccc(C(=O)NC(C(=O)O)C(C)C)cc1)c1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C25H26ClN3O3S/c1-4-13-29(25-27-21(15-33-25)19-7-5-6-8-20(19)26)14-17-9-11-18(12-10-17)23(30)28-22(16(2)3)24(31)32/h4-12,15-16,22H,1,13-14H2,2-3H3,(H,28,30)(H,31,32) |
| InChIKey | GPZBWFMJGKCRLX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|