C28H26Cl2N4OS — CID 23856623
N-[[3-(aminomethyl)phenyl]methyl]-4-[[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzamide (PubChem CID 23856623) has the molecular formula C28H26Cl2N4OS and a molecular weight of 537.52 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-4-[[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-4-[[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzamide |
|---|---|
| PubChem CID | 23856623 |
| Molecular Formula | C28H26Cl2N4OS |
| Molecular Weight | 537.52 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-4-[[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzamide |
| SMILES | C=CCN(Cc1ccc(C(=O)NCc2cccc(CN)c2)cc1)c1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C28H26Cl2N4OS/c1-2-12-34(28-33-26(18-36-28)23-10-11-24(29)25(30)14-23)17-19-6-8-22(9-7-19)27(35)32-16-21-5-3-4-20(13-21)15-31/h2-11,13-14,18H,1,12,15-17,31H2,(H,32,35) |
| InChIKey | YOXCGSGTKQDXGH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|