C28H27N5O3S — CID 11713253
N-[[3-(aminomethyl)phenyl]methyl]-4-[[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzamide (PubChem CID 11713253) has the molecular formula C28H27N5O3S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-4-[[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-4-[[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzamide |
|---|---|
| PubChem CID | 11713253 |
| Molecular Formula | C28H27N5O3S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-4-[[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzamide |
| SMILES | C=CCN(Cc1ccc(C(=O)NCc2cccc(CN)c2)cc1)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C28H27N5O3S/c1-2-13-32(28-31-26(19-37-28)24-7-4-8-25(15-24)33(35)36)18-20-9-11-23(12-10-20)27(34)30-17-22-6-3-5-21(14-22)16-29/h2-12,14-15,19H,1,13,16-18,29H2,(H,30,34) |
| InChIKey | KQKZQAKMZXPYPP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|