C23H22N4O5S — CID 11597919
2-[methyl-[4-[[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]amino]acetic acid (PubChem CID 11597919) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-[methyl-[4-[[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[4-[[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 11597919 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-[methyl-[4-[[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-prop-2-enylamino]methyl]benzoyl]amino]acetic acid |
| SMILES | C=CCN(Cc1ccc(C(=O)N(C)CC(=O)O)cc1)c1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C23H22N4O5S/c1-3-11-26(13-16-7-9-17(10-8-16)22(30)25(2)14-21(28)29)23-24-20(15-33-23)18-5-4-6-19(12-18)27(31)32/h3-10,12,15H,1,11,13-14H2,2H3,(H,28,29) |
| InChIKey | AYLOVWGSEWLZLT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|