C14H14ClN3S — CID 23857093
1-(2-chloro-3-pyridinyl)-3-(2,6-dimethylphenyl)thiourea (PubChem CID 23857093) has the molecular formula C14H14ClN3S and a molecular weight of 291.81 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-3-(2,6-dimethylphenyl)thiourea.
| Compound Name | 1-(2-chloro-3-pyridinyl)-3-(2,6-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 23857093 |
| Molecular Formula | C14H14ClN3S |
| Molecular Weight | 291.81 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-3-(2,6-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)Nc1cccnc1Cl |
| InChI | InChI=1S/C14H14ClN3S/c1-9-5-3-6-10(2)12(9)18-14(19)17-11-7-4-8-16-13(11)15/h3-8H,1-2H3,(H2,17,18,19) |
| InChIKey | YQJZJBMDHWRESV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|