C24H21N3O2 — CID 23876950
N,N-dimethyl-4-(4-phenylmethoxyphthalazin-1-yl)benzamide (PubChem CID 23876950) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-phenylmethoxyphthalazin-1-yl)benzamide.
| Compound Name | N,N-dimethyl-4-(4-phenylmethoxyphthalazin-1-yl)benzamide |
|---|---|
| PubChem CID | 23876950 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N,N-dimethyl-4-(4-phenylmethoxyphthalazin-1-yl)benzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2nnc(OCc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H21N3O2/c1-27(2)24(28)19-14-12-18(13-15-19)22-20-10-6-7-11-21(20)23(26-25-22)29-16-17-8-4-3-5-9-17/h3-15H,16H2,1-2H3 |
| InChIKey | JLSPCOJODOWOPF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |