C25H24BrClN2O4S — CID 23878524
N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-4-[butyl(methyl)sulfamoyl]benzamide (PubChem CID 23878524) has the molecular formula C25H24BrClN2O4S and a molecular weight of 563.90 g/mol. Its IUPAC name is N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-4-[butyl(methyl)sulfamoyl]benzamide.
| Compound Name | N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-4-[butyl(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 23878524 |
| Molecular Formula | C25H24BrClN2O4S |
| Molecular Weight | 563.90 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | N-[4-bromo-2-(2-chlorobenzoyl)phenyl]-4-[butyl(methyl)sulfamoyl]benzamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(Br)cc2C(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H24BrClN2O4S/c1-3-4-15-29(2)34(32,33)19-12-9-17(10-13-19)25(31)28-23-14-11-18(26)16-21(23)24(30)20-7-5-6-8-22(20)27/h5-14,16H,3-4,15H2,1-2H3,(H,28,31) |
| InChIKey | RMFZACOCCAJYIS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.90 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |