C28H38N2O2S — CID 23880187
N,N-dicyclohexyl-2-(3-methylbutanoylamino)-4-phenylthiophene-3-carboxamide (PubChem CID 23880187) has the molecular formula C28H38N2O2S and a molecular weight of 466.69 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-(3-methylbutanoylamino)-4-phenylthiophene-3-carboxamide.
| Compound Name | N,N-dicyclohexyl-2-(3-methylbutanoylamino)-4-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 23880187 |
| Molecular Formula | C28H38N2O2S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | N,N-dicyclohexyl-2-(3-methylbutanoylamino)-4-phenylthiophene-3-carboxamide |
| SMILES | CC(C)CC(=O)Nc1scc(-c2ccccc2)c1C(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C28H38N2O2S/c1-20(2)18-25(31)29-27-26(24(19-33-27)21-12-6-3-7-13-21)28(32)30(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3,6-7,12-13,19-20,22-23H,4-5,8-11,14-18H2,1-2H3,(H,29,31) |
| InChIKey | NFVHVDNRQHWNJQ-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |