C30H23BrN2O4 — CID 23880981
6-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione (PubChem CID 23880981) has the molecular formula C30H23BrN2O4 and a molecular weight of 555.43 g/mol. Its IUPAC name is 6-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione.
| Compound Name | 6-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
|---|---|
| PubChem CID | 23880981 |
| Molecular Formula | C30H23BrN2O4 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 6-[[3-bromo-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7-dione |
| SMILES | COc1cc(C=NN2C(=O)c3ccc4c5c(ccc(c35)C2=O)CC4)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C30H23BrN2O4/c1-17-3-5-18(6-4-17)16-37-28-24(31)13-19(14-25(28)36-2)15-32-33-29(34)22-11-9-20-7-8-21-10-12-23(30(33)35)27(22)26(20)21/h3-6,9-15H,7-8,16H2,1-2H3 |
| InChIKey | VSRNWJCDNNFGSV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|