About (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate
(4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate (PubChem CID 23882023) has the molecular formula C17H15N3O4
and a molecular weight of 325.32 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate |
| PubChem CID | 23882023 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate |
| SMILES | CCNc1ccc(C(=O)OCc2ccc(C#N)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N3O4/c1-2-19-15-8-7-14(9-16(15)20(22)23)17(21)24-11-13-5-3-12(10-18)4-6-13/h3-9,19H,2,11H2,1H3 |
| InChIKey | MZVYBXSXBASQAL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate?
The IUPAC name of (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate (CID 23882023) is (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate.
What is the SMILES notation for (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate?
The canonical SMILES for (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate is CCNc1ccc(C(=O)OCc2ccc(C#N)cc2)cc1[N+](=O)[O-].
What is the InChIKey of (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate?
The InChIKey is MZVYBXSXBASQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O4/c1-2-19-15-8-7-14(9-16(15)20(22)23)17(21)24-11-13-5-3-12(10-18)4-6-13/h3-9,19H,2,11H2,1H3.
What are the key properties of (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate?
(4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate has a molecular weight of 325.32 g/mol, XLogP of 3.26, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 4-(ethylamino)-3-nitrobenzoate is sourced from PubChem (CID 23882023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).