C20H23N3O6 — CID 9112964
[2-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-2-oxoethyl] 4-(ethylamino)-3-nitrobenzoate (PubChem CID 9112964) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is [2-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-2-oxoethyl] 4-(ethylamino)-3-nitrobenzoate.
| Compound Name | [2-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-2-oxoethyl] 4-(ethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 9112964 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [2-[(4-hydroxy-3,5-dimethylphenyl)methylamino]-2-oxoethyl] 4-(ethylamino)-3-nitrobenzoate |
| SMILES | CCNc1ccc(C(=O)OCC(=O)NCc2cc(C)c(O)c(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N3O6/c1-4-21-16-6-5-15(9-17(16)23(27)28)20(26)29-11-18(24)22-10-14-7-12(2)19(25)13(3)8-14/h5-9,21,25H,4,10-11H2,1-3H3,(H,22,24) |
| InChIKey | SNFIMSRXCQQOQA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|