C28H31IN2O3 — CID 23882177
[2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-(2-methylbutan-2-yl)-1,2,3,4-tetrahydroacridine-9-carboxylate (PubChem CID 23882177) has the molecular formula C28H31IN2O3 and a molecular weight of 570.47 g/mol. Its IUPAC name is [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-(2-methylbutan-2-yl)-1,2,3,4-tetrahydroacridine-9-carboxylate.
| Compound Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-(2-methylbutan-2-yl)-1,2,3,4-tetrahydroacridine-9-carboxylate |
|---|---|
| PubChem CID | 23882177 |
| Molecular Formula | C28H31IN2O3 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-(2-methylbutan-2-yl)-1,2,3,4-tetrahydroacridine-9-carboxylate |
| SMILES | CCC(C)(C)C1CCc2nc3ccccc3c(C(=O)OCC(=O)Nc3ccc(I)cc3C)c2C1 |
| InChI | InChI=1S/C28H31IN2O3/c1-5-28(3,4)18-10-12-24-21(15-18)26(20-8-6-7-9-23(20)30-24)27(33)34-16-25(32)31-22-13-11-19(29)14-17(22)2/h6-9,11,13-14,18H,5,10,12,15-16H2,1-4H3,(H,31,32) |
| InChIKey | CKBNBRSENWQPIR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|