C20H21N5OS3 — CID 23885949
2-amino-4-(2,5-dimethylthiophen-3-yl)-7,7-dimethyl-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 23885949) has the molecular formula C20H21N5OS3 and a molecular weight of 443.62 g/mol. Its IUPAC name is 2-amino-4-(2,5-dimethylthiophen-3-yl)-7,7-dimethyl-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(2,5-dimethylthiophen-3-yl)-7,7-dimethyl-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23885949 |
| Molecular Formula | C20H21N5OS3 |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-amino-4-(2,5-dimethylthiophen-3-yl)-7,7-dimethyl-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | Cc1cc(C2C(C#N)=C(N)N(c3n[nH]c(=S)s3)C3=C2C(=O)CC(C)(C)C3)c(C)s1 |
| InChI | InChI=1S/C20H21N5OS3/c1-9-5-11(10(2)28-9)15-12(8-21)17(22)25(18-23-24-19(27)29-18)13-6-20(3,4)7-14(26)16(13)15/h5,15H,6-7,22H2,1-4H3,(H,24,27) |
| InChIKey | VJQUBPIVSHIEKJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|