C22H23N5O3S2 — CID 23997736
2-amino-4-(2,4-dimethoxyphenyl)-7,7-dimethyl-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 23997736) has the molecular formula C22H23N5O3S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-amino-4-(2,4-dimethoxyphenyl)-7,7-dimethyl-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(2,4-dimethoxyphenyl)-7,7-dimethyl-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23997736 |
| Molecular Formula | C22H23N5O3S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 2-amino-4-(2,4-dimethoxyphenyl)-7,7-dimethyl-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(N)N(c3n[nH]c(=S)s3)C3=C2C(=O)CC(C)(C)C3)c(OC)c1 |
| InChI | InChI=1S/C22H23N5O3S2/c1-22(2)8-14-18(15(28)9-22)17(12-6-5-11(29-3)7-16(12)30-4)13(10-23)19(24)27(14)20-25-26-21(31)32-20/h5-7,17H,8-9,24H2,1-4H3,(H,26,31) |
| InChIKey | BTODGZKZEPMXLK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|