C19H17N5OS2 — CID 23969940
2-amino-4-(2-methylphenyl)-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 23969940) has the molecular formula C19H17N5OS2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-amino-4-(2-methylphenyl)-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(2-methylphenyl)-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 23969940 |
| Molecular Formula | C19H17N5OS2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-amino-4-(2-methylphenyl)-5-oxo-1-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1ccccc1C1C(C#N)=C(N)N(c2n[nH]c(=S)s2)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C19H17N5OS2/c1-10-5-2-3-6-11(10)15-12(9-20)17(21)24(18-22-23-19(26)27-18)13-7-4-8-14(25)16(13)15/h2-3,5-6,15H,4,7-8,21H2,1H3,(H,23,26) |
| InChIKey | DPRPXRJZQZCKLZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|