C26H24N4O2S — CID 23886369
2-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butanoylamino]benzamide (PubChem CID 23886369) has the molecular formula C26H24N4O2S and a molecular weight of 456.57 g/mol. Its IUPAC name is 2-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butanoylamino]benzamide.
| Compound Name | 2-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butanoylamino]benzamide |
|---|---|
| PubChem CID | 23886369 |
| Molecular Formula | C26H24N4O2S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butanoylamino]benzamide |
| SMILES | CCC(Sc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C26H24N4O2S/c1-2-21(25(32)28-20-16-10-9-15-19(20)24(27)31)33-26-29-22(17-11-5-3-6-12-17)23(30-26)18-13-7-4-8-14-18/h3-16,21H,2H2,1H3,(H2,27,31)(H,28,32)(H,29,30) |
| InChIKey | MHHIQRQCFCKTMM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |