C11H14Br2O4 — CID 23892316
(1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methoxybutane-1,4-diol (PubChem CID 23892316) has the molecular formula C11H14Br2O4 and a molecular weight of 370.04 g/mol. Its IUPAC name is (1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methoxybutane-1,4-diol.
| Compound Name | (1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methoxybutane-1,4-diol |
|---|---|
| PubChem CID | 23892316 |
| Molecular Formula | C11H14Br2O4 |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | (1S,2S)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methoxybutane-1,4-diol |
| SMILES | CO[C@@H](CCO)[C@@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C11H14Br2O4/c1-17-9(2-3-14)11(16)7-4-6(12)5-8(13)10(7)15/h4-5,9,11,14-16H,2-3H2,1H3/t9-,11-/m0/s1 |
| InChIKey | ORPDVKZYCKGREU-ONGXEEELSA-N |
| XLogP | 2.35 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |