C37H48N4O5 — CID 23896151
(5R,6S,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23896151) has the molecular formula C37H48N4O5 and a molecular weight of 628.81 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23896151 |
| Molecular Formula | C37H48N4O5 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(2-hydroxyethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)c3ccc(N(CC)CC)cc3)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C37H48N4O5/c1-6-22-39(26-27-14-12-11-13-15-27)33(43)30-31-34(44)41(24-25-42)32(37(31)21-20-36(30,8-3)46-37)35(45)40(23-7-2)29-18-16-28(17-19-29)38(9-4)10-5/h6-7,11-19,30-32,42H,1-2,8-10,20-26H2,3-5H3/t30-,31+,32?,36+,37?/m1/s1 |
| InChIKey | BBTGUBFBAMXNHB-UNOQEUKUSA-N |
| XLogP | 4.41 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|