C28H36N2O6 — CID 23950982
but-3-enyl (5R,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-7-ethyl-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23950982) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is but-3-enyl (5R,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-7-ethyl-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5R,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-7-ethyl-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23950982 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | but-3-enyl (5R,6S,7S)-2-[benzyl(prop-2-enyl)carbamoyl]-7-ethyl-3-(2-hydroxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)Cc3ccccc3)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C28H36N2O6/c1-4-7-18-35-26(34)22-21-24(32)30(16-17-31)23(28(21)14-13-27(22,6-3)36-28)25(33)29(15-5-2)19-20-11-9-8-10-12-20/h4-5,8-12,21-23,31H,1-2,6-7,13-19H2,3H3/t21-,22+,23?,27-,28?/m0/s1 |
| InChIKey | KRZCSCGKAKOLEH-PJDCMPEISA-N |
| XLogP | 2.47 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|