C24H29FN2O4Si — CID 23901727
2-[(2R,3R,4R)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]phthalazin-1-one (PubChem CID 23901727) has the molecular formula C24H29FN2O4Si and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[(2R,3R,4R)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]phthalazin-1-one.
| Compound Name | 2-[(2R,3R,4R)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]phthalazin-1-one |
|---|---|
| PubChem CID | 23901727 |
| Molecular Formula | C24H29FN2O4Si |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-[(2R,3R,4R)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]phthalazin-1-one |
| SMILES | CO[C@H]1c2cc(-n3ncc4ccccc4c3=O)ccc2O[C@@H](C(CCO)[Si](C)(C)F)[C@@H]1C |
| InChI | InChI=1S/C24H29FN2O4Si/c1-15-22(30-2)19-13-17(27-24(29)18-8-6-5-7-16(18)14-26-27)9-10-20(19)31-23(15)21(11-12-28)32(3,4)25/h5-10,13-15,21-23,28H,11-12H2,1-4H3/t15-,21?,22-,23-/m1/s1 |
| InChIKey | SAKKLPPQTYYSQH-NTPOECHASA-N |
| XLogP | 4.40 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|